C10H16N2O3 — CID 114418372
2-[but-3-yn-2-ylcarbamoyl(propyl)amino]acetic acid (PubChem CID 114418372) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[but-3-yn-2-ylcarbamoyl(propyl)amino]acetic acid.
| Compound Name | 2-[but-3-yn-2-ylcarbamoyl(propyl)amino]acetic acid |
|---|---|
| PubChem CID | 114418372 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[but-3-yn-2-ylcarbamoyl(propyl)amino]acetic acid |
| SMILES | C#CC(C)NC(=O)N(CCC)CC(=O)O |
| InChI | InChI=1S/C10H16N2O3/c1-4-6-12(7-9(13)14)10(15)11-8(3)5-2/h2,8H,4,6-7H2,1,3H3,(H,11,15)(H,13,14) |
| InChIKey | STAMIUDOGAESNW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|