C15H16N2O3 — CID 114418454
2-(but-3-yn-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid (PubChem CID 114418454) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(but-3-yn-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid.
| Compound Name | 2-(but-3-yn-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 114418454 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(but-3-yn-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinoline-5-carboxylic acid |
| SMILES | C#CC(C)NC(=O)N1CCc2c(cccc2C(=O)O)C1 |
| InChI | InChI=1S/C15H16N2O3/c1-3-10(2)16-15(20)17-8-7-12-11(9-17)5-4-6-13(12)14(18)19/h1,4-6,10H,7-9H2,2H3,(H,16,20)(H,18,19) |
| InChIKey | LFVOHZXCKMKAKX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|