C25H25FN4S — CID 11441855
1-[[5-(2-fluorophenyl)-1-(4-thiophen-3-ylphenyl)pyrazol-4-yl]methyl]-4-methylpiperazine (PubChem CID 11441855) has the molecular formula C25H25FN4S and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[[5-(2-fluorophenyl)-1-(4-thiophen-3-ylphenyl)pyrazol-4-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[5-(2-fluorophenyl)-1-(4-thiophen-3-ylphenyl)pyrazol-4-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 11441855 |
| Molecular Formula | C25H25FN4S |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[[5-(2-fluorophenyl)-1-(4-thiophen-3-ylphenyl)pyrazol-4-yl]methyl]-4-methylpiperazine |
| SMILES | CN1CCN(Cc2cnn(-c3ccc(-c4ccsc4)cc3)c2-c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H25FN4S/c1-28-11-13-29(14-12-28)17-21-16-27-30(25(21)23-4-2-3-5-24(23)26)22-8-6-19(7-9-22)20-10-15-31-18-20/h2-10,15-16,18H,11-14,17H2,1H3 |
| InChIKey | BKNSFOUPJJXVAG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |