C11H18N2O3 — CID 114418650
2-(but-3-yn-2-ylcarbamoylamino)-3-methylpentanoic acid (PubChem CID 114418650) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-(but-3-yn-2-ylcarbamoylamino)-3-methylpentanoic acid.
| Compound Name | 2-(but-3-yn-2-ylcarbamoylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 114418650 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-(but-3-yn-2-ylcarbamoylamino)-3-methylpentanoic acid |
| SMILES | C#CC(C)NC(=O)NC(C(=O)O)C(C)CC |
| InChI | InChI=1S/C11H18N2O3/c1-5-7(3)9(10(14)15)13-11(16)12-8(4)6-2/h2,7-9H,5H2,1,3-4H3,(H,14,15)(H2,12,13,16) |
| InChIKey | VDMWBHXYTLTKGO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|