C20H26N4O7 — CID 11441901
dimethyl (2S,3S)-3-benzamido-2-(dimethylamino)-1-(methoxycarbonylamino)-5-methyl-2H-pyrrole-3,4-dicarboxylate (PubChem CID 11441901) has the molecular formula C20H26N4O7 and a molecular weight of 434.45 g/mol. Its IUPAC name is dimethyl (2S,3S)-3-benzamido-2-(dimethylamino)-1-(methoxycarbonylamino)-5-methyl-2H-pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl (2S,3S)-3-benzamido-2-(dimethylamino)-1-(methoxycarbonylamino)-5-methyl-2H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11441901 |
| Molecular Formula | C20H26N4O7 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | dimethyl (2S,3S)-3-benzamido-2-(dimethylamino)-1-(methoxycarbonylamino)-5-methyl-2H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)NN1C(C)=C(C(=O)OC)[C@@](NC(=O)c2ccccc2)(C(=O)OC)[C@H]1N(C)C |
| InChI | InChI=1S/C20H26N4O7/c1-12-14(16(26)29-4)20(18(27)30-5,21-15(25)13-10-8-7-9-11-13)17(23(2)3)24(12)22-19(28)31-6/h7-11,17H,1-6H3,(H,21,25)(H,22,28)/t17-,20-/m0/s1 |
| InChIKey | ZZCSXXSHGMRHAZ-PXNSSMCTSA-N |
| XLogP | 0.25 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|