About 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine
1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine (PubChem CID 114420316) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine |
| PubChem CID | 114420316 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine |
| SMILES | CC(C)Cc1cc(C(C)N)on1 |
| InChI | InChI=1S/C9H16N2O/c1-6(2)4-8-5-9(7(3)10)12-11-8/h5-7H,4,10H2,1-3H3 |
| InChIKey | LFOFXUYDKSLQHA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine?
The IUPAC name of 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine (CID 114420316) is 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine.
What is the SMILES notation for 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine?
The canonical SMILES for 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine is CC(C)Cc1cc(C(C)N)on1.
What is the InChIKey of 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine?
The InChIKey is LFOFXUYDKSLQHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-6(2)4-8-5-9(7(3)10)12-11-8/h5-7H,4,10H2,1-3H3.
What are the key properties of 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine?
1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine has a molecular weight of 168.24 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-methylpropyl)-1,2-oxazol-5-yl]ethanamine is sourced from PubChem (CID 114420316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).