C10H14N4O — CID 114420343
1-[3-(3-ethylimidazol-4-yl)-1,2-oxazol-5-yl]ethanamine (PubChem CID 114420343) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-[3-(3-ethylimidazol-4-yl)-1,2-oxazol-5-yl]ethanamine.
| Compound Name | 1-[3-(3-ethylimidazol-4-yl)-1,2-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 114420343 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-[3-(3-ethylimidazol-4-yl)-1,2-oxazol-5-yl]ethanamine |
| SMILES | CCn1cncc1-c1cc(C(C)N)on1 |
| InChI | InChI=1S/C10H14N4O/c1-3-14-6-12-5-9(14)8-4-10(7(2)11)15-13-8/h4-7H,3,11H2,1-2H3 |
| InChIKey | KZXYWWGAFKJAPQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |