About 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione
1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione (PubChem CID 114420529) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione |
| PubChem CID | 114420529 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione |
| SMILES | C#CC(C)N1C(=O)C(C)(C)NC(=O)C1c1ccccc1 |
| InChI | InChI=1S/C16H18N2O2/c1-5-11(2)18-13(12-9-7-6-8-10-12)14(19)17-16(3,4)15(18)20/h1,6-11,13H,2-4H3,(H,17,19) |
| InChIKey | RYPLWZYQLLZDTN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione?
The IUPAC name of 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione (CID 114420529) is 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione.
What is the SMILES notation for 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione?
The canonical SMILES for 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione is C#CC(C)N1C(=O)C(C)(C)NC(=O)C1c1ccccc1.
What is the InChIKey of 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione?
The InChIKey is RYPLWZYQLLZDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-5-11(2)18-13(12-9-7-6-8-10-12)14(19)17-16(3,4)15(18)20/h1,6-11,13H,2-4H3,(H,17,19).
What are the key properties of 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione?
1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione has a molecular weight of 270.33 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-yn-2-yl-3,3-dimethyl-6-phenylpiperazine-2,5-dione is sourced from PubChem (CID 114420529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).