C14H20N2O2 — CID 114420556
1-but-3-yn-2-yl-3-cyclohexylpiperazine-2,5-dione (PubChem CID 114420556) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-but-3-yn-2-yl-3-cyclohexylpiperazine-2,5-dione.
| Compound Name | 1-but-3-yn-2-yl-3-cyclohexylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 114420556 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-but-3-yn-2-yl-3-cyclohexylpiperazine-2,5-dione |
| SMILES | C#CC(C)N1CC(=O)NC(C2CCCCC2)C1=O |
| InChI | InChI=1S/C14H20N2O2/c1-3-10(2)16-9-12(17)15-13(14(16)18)11-7-5-4-6-8-11/h1,10-11,13H,4-9H2,2H3,(H,15,17) |
| InChIKey | YNXLJZWMSFOWGP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|