C16H25N3O — CID 114420644
4-amino-1-but-3-yn-2-yl-7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 114420644) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-amino-1-but-3-yn-2-yl-7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-amino-1-but-3-yn-2-yl-7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 114420644 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 4-amino-1-but-3-yn-2-yl-7,7,9,9-tetramethyl-1,3-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | C#CC(C)N1C(=O)N=C(N)C12CC(C)(C)CC(C)(C)C2 |
| InChI | InChI=1S/C16H25N3O/c1-7-11(2)19-13(20)18-12(17)16(19)9-14(3,4)8-15(5,6)10-16/h1,11H,8-10H2,2-6H3,(H2,17,18,20) |
| InChIKey | AVJXLLPNFUQSKO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|