C10H13N3O3S — CID 114420955
4-amino-1-but-3-yn-2-yl-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-3-en-2-one (PubChem CID 114420955) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-amino-1-but-3-yn-2-yl-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-3-en-2-one.
| Compound Name | 4-amino-1-but-3-yn-2-yl-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-3-en-2-one |
|---|---|
| PubChem CID | 114420955 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-amino-1-but-3-yn-2-yl-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-3-en-2-one |
| SMILES | C#CC(C)N1C(=O)N=C(N)C12CCS(=O)(=O)C2 |
| InChI | InChI=1S/C10H13N3O3S/c1-3-7(2)13-9(14)12-8(11)10(13)4-5-17(15,16)6-10/h1,7H,4-6H2,2H3,(H2,11,12,14) |
| InChIKey | JJZIYTQPDQWEOJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|