C14H18N2O3 — CID 114421001
4-but-3-yn-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione (PubChem CID 114421001) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-but-3-yn-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione.
| Compound Name | 4-but-3-yn-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione |
|---|---|
| PubChem CID | 114421001 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-but-3-yn-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione |
| SMILES | C#CC(C)N1C(=O)NC(=O)C2(CCCCCC2)C1=O |
| InChI | InChI=1S/C14H18N2O3/c1-3-10(2)16-12(18)14(11(17)15-13(16)19)8-6-4-5-7-9-14/h1,10H,4-9H2,2H3,(H,15,17,19) |
| InChIKey | PADRMQLFIXIDGH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|