C23H33N5O4 — CID 11442130
(2S)-1-[(2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 11442130) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 11442130 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(methylamino)propanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CN[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C23H33N5O4/c1-25-19(13-15-14-26-17-8-3-2-7-16(15)17)21(29)27-18(9-4-5-11-24)22(30)28-12-6-10-20(28)23(31)32/h2-3,7-8,14,18-20,25-26H,4-6,9-13,24H2,1H3,(H,27,29)(H,31,32)/t18-,19-,20-/m0/s1 |
| InChIKey | HBNMTAKKOHWSRE-UFYCRDLUSA-N |
| XLogP | 0.99 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|