C17H23NO3 — CID 114421816
4-methyl-1-(2,4,6-trimethylbenzoyl)piperidine-2-carboxylic acid (PubChem CID 114421816) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-methyl-1-(2,4,6-trimethylbenzoyl)piperidine-2-carboxylic acid.
| Compound Name | 4-methyl-1-(2,4,6-trimethylbenzoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114421816 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-methyl-1-(2,4,6-trimethylbenzoyl)piperidine-2-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)N2CCC(C)CC2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H23NO3/c1-10-5-6-18(14(9-10)17(20)21)16(19)15-12(3)7-11(2)8-13(15)4/h7-8,10,14H,5-6,9H2,1-4H3,(H,20,21) |
| InChIKey | AITGNKWWEAOIFG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |