C26H23ClN2O3 — CID 11442232
(4-methylphenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 11442232) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is (4-methylphenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methylphenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 11442232 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (4-methylphenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H23ClN2O3/c1-16-3-8-20(9-4-16)32-26(30)29-14-13-21-22-15-18(27)7-12-23(22)28-24(21)25(29)17-5-10-19(31-2)11-6-17/h3-12,15,25,28H,13-14H2,1-2H3 |
| InChIKey | YCGZXOVOFUPVNR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|