C28H37FN2O2 — CID 11442368
(4R,4'aS,5R)-4,5-dibutyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] (PubChem CID 11442368) has the molecular formula C28H37FN2O2 and a molecular weight of 452.61 g/mol. Its IUPAC name is (4R,4'aS,5R)-4,5-dibutyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole].
| Compound Name | (4R,4'aS,5R)-4,5-dibutyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
|---|---|
| PubChem CID | 11442368 |
| Molecular Formula | C28H37FN2O2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (4R,4'aS,5R)-4,5-dibutyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
| SMILES | CCCC[C@H]1OC2(CCCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)O[C@@H]1CCCC |
| InChI | InChI=1S/C28H37FN2O2/c1-4-6-10-25-26(11-7-5-2)33-28(32-25)16-8-9-21-17-24-20(18-27(21,28)3)19-30-31(24)23-14-12-22(29)13-15-23/h12-15,17,19,25-26H,4-11,16,18H2,1-3H3/t25-,26-,27+/m1/s1 |
| InChIKey | CMJPJNBMUFZCAM-PFBJBMPXSA-N |
| XLogP | 7.00 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |