C13H19N3O — CID 114424331
4-methyl-N-(6-methyl-3-pyridinyl)piperidine-2-carboxamide (PubChem CID 114424331) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-methyl-N-(6-methyl-3-pyridinyl)piperidine-2-carboxamide.
| Compound Name | 4-methyl-N-(6-methyl-3-pyridinyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114424331 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-methyl-N-(6-methyl-3-pyridinyl)piperidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC(C)CCN2)cn1 |
| InChI | InChI=1S/C13H19N3O/c1-9-5-6-14-12(7-9)13(17)16-11-4-3-10(2)15-8-11/h3-4,8-9,12,14H,5-7H2,1-2H3,(H,16,17) |
| InChIKey | XOJBLJLRBQGWSH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |