About 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane
2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane (PubChem CID 11442466) has the molecular formula C27H52O5
and a molecular weight of 456.71 g/mol. Its IUPAC name is 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane.
Molecular Properties
| Compound Name | 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane |
| PubChem CID | 11442466 |
| Molecular Formula | C27H52O5 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane |
| SMILES | CC(C)(CCCCCOCCCCC(C)(C)COC1CCCCO1)COC1CCCCO1 |
| InChI | InChI=1S/C27H52O5/c1-26(2,22-31-24-14-6-11-20-29-24)16-8-5-10-18-28-19-13-9-17-27(3,4)23-32-25-15-7-12-21-30-25/h24-25H,5-23H2,1-4H3 |
| InChIKey | ZVSDLTCWEHNYPL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane?
The IUPAC name of 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane (CID 11442466) is 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane.
What is the SMILES notation for 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane?
The canonical SMILES for 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane is CC(C)(CCCCCOCCCCC(C)(C)COC1CCCCO1)COC1CCCCO1.
What is the InChIKey of 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane?
The InChIKey is ZVSDLTCWEHNYPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H52O5/c1-26(2,22-31-24-14-6-11-20-29-24)16-8-5-10-18-28-19-13-9-17-27(3,4)23-32-25-15-7-12-21-30-25/h24-25H,5-23H2,1-4H3.
What are the key properties of 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane?
2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane has a molecular weight of 456.71 g/mol, XLogP of 6.87, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[6,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-2,2-dimethylhexoxy]oxane is sourced from PubChem (CID 11442466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).