About 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide
2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide (PubChem CID 11442606) has the molecular formula C21H17BrF2N2O3
and a molecular weight of 463.28 g/mol. Its IUPAC name is 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide |
| PubChem CID | 11442606 |
| Molecular Formula | C21H17BrF2N2O3 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccccc1Cn1ccc(OCc2ccc(F)cc2F)c(Br)c1=O |
| InChI | InChI=1S/C21H17BrF2N2O3/c22-20-18(29-12-15-5-6-16(23)10-17(15)24)7-8-26(21(20)28)11-14-4-2-1-3-13(14)9-19(25)27/h1-8,10H,9,11-12H2,(H2,25,27) |
| InChIKey | HVKWPDPXCVFTGZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide?
The IUPAC name of 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide (CID 11442606) is 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide.
What is the SMILES notation for 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide?
The canonical SMILES for 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide is NC(=O)Cc1ccccc1Cn1ccc(OCc2ccc(F)cc2F)c(Br)c1=O.
What is the InChIKey of 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide?
The InChIKey is HVKWPDPXCVFTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17BrF2N2O3/c22-20-18(29-12-15-5-6-16(23)10-17(15)24)7-8-26(21(20)28)11-14-4-2-1-3-13(14)9-19(25)27/h1-8,10H,9,11-12H2,(H2,25,27).
What are the key properties of 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide?
2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide has a molecular weight of 463.28 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2-oxo-1-pyridinyl]methyl]phenyl]acetamide is sourced from PubChem (CID 11442606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).