C23H44O9 — CID 11442654
[(3S,5R,8R,9R)-9-hydroxy-3,5,8-tris(methoxymethoxy)dodec-11-enyl] 2,2-dimethylpropanoate (PubChem CID 11442654) has the molecular formula C23H44O9 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(3S,5R,8R,9R)-9-hydroxy-3,5,8-tris(methoxymethoxy)dodec-11-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,5R,8R,9R)-9-hydroxy-3,5,8-tris(methoxymethoxy)dodec-11-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11442654 |
| Molecular Formula | C23H44O9 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | [(3S,5R,8R,9R)-9-hydroxy-3,5,8-tris(methoxymethoxy)dodec-11-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@@H](O)[C@@H](CC[C@H](C[C@H](CCOC(=O)C(C)(C)C)OCOC)OCOC)OCOC |
| InChI | InChI=1S/C23H44O9/c1-8-9-20(24)21(32-17-28-7)11-10-18(30-15-26-5)14-19(31-16-27-6)12-13-29-22(25)23(2,3)4/h8,18-21,24H,1,9-17H2,2-7H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | BMTRCUNGSMYBCN-PLACYPQZSA-N |
| XLogP | 3.04 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|