C9H15F2NO4S — CID 114427433
1-(difluoromethylsulfonyl)-4-ethylpiperidine-2-carboxylic acid (PubChem CID 114427433) has the molecular formula C9H15F2NO4S and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-4-ethylpiperidine-2-carboxylic acid.
| Compound Name | 1-(difluoromethylsulfonyl)-4-ethylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114427433 |
| Molecular Formula | C9H15F2NO4S |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-4-ethylpiperidine-2-carboxylic acid |
| SMILES | CCC1CCN(S(=O)(=O)C(F)F)C(C(=O)O)C1 |
| InChI | InChI=1S/C9H15F2NO4S/c1-2-6-3-4-12(7(5-6)8(13)14)17(15,16)9(10)11/h6-7,9H,2-5H2,1H3,(H,13,14) |
| InChIKey | PBFIKEUPLVHIOU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |