C16H23N3 — CID 114427691
2-(4-ethylpiperidin-2-yl)-1,5-dimethylbenzimidazole (PubChem CID 114427691) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-(4-ethylpiperidin-2-yl)-1,5-dimethylbenzimidazole.
| Compound Name | 2-(4-ethylpiperidin-2-yl)-1,5-dimethylbenzimidazole |
|---|---|
| PubChem CID | 114427691 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2-(4-ethylpiperidin-2-yl)-1,5-dimethylbenzimidazole |
| SMILES | CCC1CCNC(c2nc3cc(C)ccc3n2C)C1 |
| InChI | InChI=1S/C16H23N3/c1-4-12-7-8-17-14(10-12)16-18-13-9-11(2)5-6-15(13)19(16)3/h5-6,9,12,14,17H,4,7-8,10H2,1-3H3 |
| InChIKey | AWMKGPHWVRCZJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |