C16H22N2O3 — CID 114428687
N-(1,3-benzodioxol-4-ylmethyl)-4-ethylpiperidine-2-carboxamide (PubChem CID 114428687) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-4-ethylpiperidine-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-4-ethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 114428687 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-4-ethylpiperidine-2-carboxamide |
| SMILES | CCC1CCNC(C(=O)NCc2cccc3c2OCO3)C1 |
| InChI | InChI=1S/C16H22N2O3/c1-2-11-6-7-17-13(8-11)16(19)18-9-12-4-3-5-14-15(12)21-10-20-14/h3-5,11,13,17H,2,6-10H2,1H3,(H,18,19) |
| InChIKey | RZDJBLFLNJKZER-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |