C15H26N2O2 — CID 114428837
3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-ethylpiperidin-2-yl)methanone (PubChem CID 114428837) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-ethylpiperidin-2-yl)methanone.
| Compound Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-ethylpiperidin-2-yl)methanone |
|---|---|
| PubChem CID | 114428837 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl-(4-ethylpiperidin-2-yl)methanone |
| SMILES | CCC1CCNC(C(=O)N2CCOC3CCCC32)C1 |
| InChI | InChI=1S/C15H26N2O2/c1-2-11-6-7-16-12(10-11)15(18)17-8-9-19-14-5-3-4-13(14)17/h11-14,16H,2-10H2,1H3 |
| InChIKey | VGPIUZGEOZWWRF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |