C24H29NO7S — CID 11442910
trans-dimethyl (3R,4R)-3-cyano-4-[(Z)-2-[(S)-(4-methylphenyl)sulfinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 11442910) has the molecular formula C24H29NO7S and a molecular weight of 475.56 g/mol. Its IUPAC name is trans-dimethyl (3R,4R)-3-cyano-4-[(Z)-2-[(S)-(4-methylphenyl)sulfinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3R,4R)-3-cyano-4-[(Z)-2-[(S)-(4-methylphenyl)sulfinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11442910 |
| Molecular Formula | C24H29NO7S |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | trans-dimethyl (3R,4R)-3-cyano-4-[(Z)-2-[(S)-(4-methylphenyl)sulfinyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H](C#N)[C@H](/C=C(/C(=O)OC(C)(C)C)[S@@](=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H29NO7S/c1-15-7-9-18(10-8-15)33(29)19(20(26)32-23(2,3)4)11-16-12-24(21(27)30-5,22(28)31-6)13-17(16)14-25/h7-11,16-17H,12-13H2,1-6H3/b19-11-/t16-,17+,33+/m1/s1 |
| InChIKey | JZJJRSRPFVZZQY-IDMGVGGUSA-N |
| XLogP | 3.21 |
| TPSA | 119.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|