C15H18ClN3O — CID 114429842
3-(4-chlorophenyl)-5-(4-ethylpiperidin-2-yl)-1,2,4-oxadiazole (PubChem CID 114429842) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(4-ethylpiperidin-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-chlorophenyl)-5-(4-ethylpiperidin-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 114429842 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(4-ethylpiperidin-2-yl)-1,2,4-oxadiazole |
| SMILES | CCC1CCNC(c2nc(-c3ccc(Cl)cc3)no2)C1 |
| InChI | InChI=1S/C15H18ClN3O/c1-2-10-7-8-17-13(9-10)15-18-14(19-20-15)11-3-5-12(16)6-4-11/h3-6,10,13,17H,2,7-9H2,1H3 |
| InChIKey | GIQDTNZKSQKTIN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |