C29H32N6O — CID 11443019
(2R,6S)-1-[2-(1H-imidazol-5-yl)ethyl]-2,6-bis(3-methyl-2-pyridinyl)-N-phenylmethoxypiperidin-4-imine (PubChem CID 11443019) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is (2R,6S)-1-[2-(1H-imidazol-5-yl)ethyl]-2,6-bis(3-methyl-2-pyridinyl)-N-phenylmethoxypiperidin-4-imine.
| Compound Name | (2R,6S)-1-[2-(1H-imidazol-5-yl)ethyl]-2,6-bis(3-methyl-2-pyridinyl)-N-phenylmethoxypiperidin-4-imine |
|---|---|
| PubChem CID | 11443019 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | (2R,6S)-1-[2-(1H-imidazol-5-yl)ethyl]-2,6-bis(3-methyl-2-pyridinyl)-N-phenylmethoxypiperidin-4-imine |
| SMILES | Cc1cccnc1[C@H]1C/C(=N\OCc2ccccc2)C[C@@H](c2ncccc2C)N1CCc1cnc[nH]1 |
| InChI | InChI=1S/C29H32N6O/c1-21-8-6-13-31-28(21)26-16-25(34-36-19-23-10-4-3-5-11-23)17-27(29-22(2)9-7-14-32-29)35(26)15-12-24-18-30-20-33-24/h3-11,13-14,18,20,26-27H,12,15-17,19H2,1-2H3,(H,30,33)/b34-25-/t26-,27+/m0/s1 |
| InChIKey | NXNQVWWMHJRACH-PDHUUPCTSA-N |
| XLogP | 5.51 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|