C14H26N2O4S — CID 114430547
4-ethyl-1-(4-methylsulfinylbutan-2-ylcarbamoyl)piperidine-2-carboxylic acid (PubChem CID 114430547) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-ethyl-1-(4-methylsulfinylbutan-2-ylcarbamoyl)piperidine-2-carboxylic acid.
| Compound Name | 4-ethyl-1-(4-methylsulfinylbutan-2-ylcarbamoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114430547 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-ethyl-1-(4-methylsulfinylbutan-2-ylcarbamoyl)piperidine-2-carboxylic acid |
| SMILES | CCC1CCN(C(=O)NC(C)CCS(C)=O)C(C(=O)O)C1 |
| InChI | InChI=1S/C14H26N2O4S/c1-4-11-5-7-16(12(9-11)13(17)18)14(19)15-10(2)6-8-21(3)20/h10-12H,4-9H2,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | HWKXGSBBMMBQSI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |