C24H25ClF2N6O — CID 11443156
13-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-4-(methoxymethyl)-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11443156) has the molecular formula C24H25ClF2N6O and a molecular weight of 486.95 g/mol. Its IUPAC name is 13-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-4-(methoxymethyl)-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 13-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-4-(methoxymethyl)-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11443156 |
| Molecular Formula | C24H25ClF2N6O |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 13-chloro-6-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-4-(methoxymethyl)-8-methyl-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | COCc1nc(N2CCN(CCc3ccc(F)c(F)c3)CC2)c2c(n1)c1c(Cl)nccc1n2C |
| InChI | InChI=1S/C24H25ClF2N6O/c1-31-18-5-7-28-23(25)20(18)21-22(31)24(30-19(29-21)14-34-2)33-11-9-32(10-12-33)8-6-15-3-4-16(26)17(27)13-15/h3-5,7,13H,6,8-12,14H2,1-2H3 |
| InChIKey | LVDUAUUVOUUFCK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|