C26H37N3O6 — CID 11443168
[(3S)-oxolan-3-yl] (2S,3S)-3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 11443168) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] (2S,3S)-3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | [(3S)-oxolan-3-yl] (2S,3S)-3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11443168 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | [(3S)-oxolan-3-yl] (2S,3S)-3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)c1cccc(C2CCN(C(=O)[C@@H]3[C@@H](C(=O)NO)CCCN3C(=O)O[C@H]3CCOC3)CC2)c1 |
| InChI | InChI=1S/C26H37N3O6/c1-17(2)19-5-3-6-20(15-19)18-8-12-28(13-9-18)25(31)23-22(24(30)27-33)7-4-11-29(23)26(32)35-21-10-14-34-16-21/h3,5-6,15,17-18,21-23,33H,4,7-14,16H2,1-2H3,(H,27,30)/t21-,22-,23-/m0/s1 |
| InChIKey | SQAQBTAZNIRVND-VABKMULXSA-N |
| XLogP | 3.03 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|