C23H18ClN5O3S — CID 1144317
N'-[2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-hydroxybenzohydrazide (PubChem CID 1144317) has the molecular formula C23H18ClN5O3S and a molecular weight of 479.95 g/mol. Its IUPAC name is N'-[2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 1144317 |
| Molecular Formula | C23H18ClN5O3S |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N'-[2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-hydroxybenzohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C23H18ClN5O3S/c24-16-12-10-15(11-13-16)21-26-28-23(29(21)17-6-2-1-3-7-17)33-14-20(31)25-27-22(32)18-8-4-5-9-19(18)30/h1-13,30H,14H2,(H,25,31)(H,27,32) |
| InChIKey | BTEPMLSBJRRYDG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|