About 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide
2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide (PubChem CID 114431775) has the molecular formula C8H8BrF3N4O2
and a molecular weight of 329.08 g/mol. Its IUPAC name is 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide.
Molecular Properties
| Compound Name | 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide |
| PubChem CID | 114431775 |
| Molecular Formula | C8H8BrF3N4O2 |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide |
| SMILES | NC(=O)CNc1cnn(CC(F)(F)F)c(=O)c1Br |
| InChI | InChI=1S/C8H8BrF3N4O2/c9-6-4(14-2-5(13)17)1-15-16(7(6)18)3-8(10,11)12/h1,14H,2-3H2,(H2,13,17) |
| InChIKey | QWCYEVXMNMUMFD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide?
The IUPAC name of 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide (CID 114431775) is 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide.
What is the SMILES notation for 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide?
The canonical SMILES for 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide is NC(=O)CNc1cnn(CC(F)(F)F)c(=O)c1Br.
What is the InChIKey of 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide?
The InChIKey is QWCYEVXMNMUMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF3N4O2/c9-6-4(14-2-5(13)17)1-15-16(7(6)18)3-8(10,11)12/h1,14H,2-3H2,(H2,13,17).
What are the key properties of 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide?
2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide has a molecular weight of 329.08 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-bromo-6-oxo-1-(2,2,2-trifluoroethyl)pyridazin-4-yl]amino]acetamide is sourced from PubChem (CID 114431775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).