C24H25FN2O6S — CID 11443183
benzyl (1R,4S,7R)-2-cyclopropyl-1-(4-fluorophenyl)-7-methylsulfonyloxy-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate (PubChem CID 11443183) has the molecular formula C24H25FN2O6S and a molecular weight of 488.54 g/mol. Its IUPAC name is benzyl (1R,4S,7R)-2-cyclopropyl-1-(4-fluorophenyl)-7-methylsulfonyloxy-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate.
| Compound Name | benzyl (1R,4S,7R)-2-cyclopropyl-1-(4-fluorophenyl)-7-methylsulfonyloxy-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate |
|---|---|
| PubChem CID | 11443183 |
| Molecular Formula | C24H25FN2O6S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | benzyl (1R,4S,7R)-2-cyclopropyl-1-(4-fluorophenyl)-7-methylsulfonyloxy-3-oxo-2,5-diazaspiro[3.4]octane-5-carboxylate |
| SMILES | CS(=O)(=O)O[C@H]1CN(C(=O)OCc2ccccc2)[C@]2(C1)C(=O)N(C1CC1)[C@@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25FN2O6S/c1-34(30,31)33-20-13-24(26(14-20)23(29)32-15-16-5-3-2-4-6-16)21(17-7-9-18(25)10-8-17)27(22(24)28)19-11-12-19/h2-10,19-21H,11-15H2,1H3/t20-,21-,24+/m1/s1 |
| InChIKey | AHODXMOQPCTKOZ-LGVFNWMJSA-N |
| XLogP | 3.00 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|