C15H17BrFN3O — CID 114432502
4-bromo-5-[(2-fluorophenyl)methylamino]-2-(2-methylpropyl)pyridazin-3-one (PubChem CID 114432502) has the molecular formula C15H17BrFN3O and a molecular weight of 354.22 g/mol. Its IUPAC name is 4-bromo-5-[(2-fluorophenyl)methylamino]-2-(2-methylpropyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-[(2-fluorophenyl)methylamino]-2-(2-methylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114432502 |
| Molecular Formula | C15H17BrFN3O |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-bromo-5-[(2-fluorophenyl)methylamino]-2-(2-methylpropyl)pyridazin-3-one |
| SMILES | CC(C)Cn1ncc(NCc2ccccc2F)c(Br)c1=O |
| InChI | InChI=1S/C15H17BrFN3O/c1-10(2)9-20-15(21)14(16)13(8-19-20)18-7-11-5-3-4-6-12(11)17/h3-6,8,10,18H,7,9H2,1-2H3 |
| InChIKey | CVSOPVVMNRIANW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |