C14H15BrClN3O — CID 114432680
5-[(4-bromophenyl)methylamino]-4-chloro-2-propan-2-ylpyridazin-3-one (PubChem CID 114432680) has the molecular formula C14H15BrClN3O and a molecular weight of 356.65 g/mol. Its IUPAC name is 5-[(4-bromophenyl)methylamino]-4-chloro-2-propan-2-ylpyridazin-3-one.
| Compound Name | 5-[(4-bromophenyl)methylamino]-4-chloro-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114432680 |
| Molecular Formula | C14H15BrClN3O |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 5-[(4-bromophenyl)methylamino]-4-chloro-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1ncc(NCc2ccc(Br)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C14H15BrClN3O/c1-9(2)19-14(20)13(16)12(8-18-19)17-7-10-3-5-11(15)6-4-10/h3-6,8-9,17H,7H2,1-2H3 |
| InChIKey | LWRARBQMWLHIPJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |