C24H29FN2O6S — CID 11443277
ethyl 3-[4-(8-fluoro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)piperidin-1-yl]propanoate;methanesulfonic acid (PubChem CID 11443277) has the molecular formula C24H29FN2O6S and a molecular weight of 492.57 g/mol. Its IUPAC name is ethyl 3-[4-(8-fluoro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)piperidin-1-yl]propanoate;methanesulfonic acid.
| Compound Name | ethyl 3-[4-(8-fluoro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)piperidin-1-yl]propanoate;methanesulfonic acid |
|---|---|
| PubChem CID | 11443277 |
| Molecular Formula | C24H29FN2O6S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl 3-[4-(8-fluoro-5H-[1]benzoxepino[4,3-b]pyridin-11-ylidene)piperidin-1-yl]propanoate;methanesulfonic acid |
| SMILES | CCOC(=O)CCN1CCC(=C2c3ccc(F)cc3OCc3cccnc32)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C23H25FN2O3.CH4O3S/c1-2-28-21(27)9-13-26-11-7-16(8-12-26)22-19-6-5-18(24)14-20(19)29-15-17-4-3-10-25-23(17)22;1-5(2,3)4/h3-6,10,14H,2,7-9,11-13,15H2,1H3;1H3,(H,2,3,4) |
| InChIKey | ZYYSNWFJYCMUGT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|