C13H16ClN3O2 — CID 114434721
4-chloro-2-ethyl-5-[1-(5-methylfuran-2-yl)ethylamino]pyridazin-3-one (PubChem CID 114434721) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 4-chloro-2-ethyl-5-[1-(5-methylfuran-2-yl)ethylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-ethyl-5-[1-(5-methylfuran-2-yl)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114434721 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-chloro-2-ethyl-5-[1-(5-methylfuran-2-yl)ethylamino]pyridazin-3-one |
| SMILES | CCn1ncc(NC(C)c2ccc(C)o2)c(Cl)c1=O |
| InChI | InChI=1S/C13H16ClN3O2/c1-4-17-13(18)12(14)10(7-15-17)16-9(3)11-6-5-8(2)19-11/h5-7,9,16H,4H2,1-3H3 |
| InChIKey | VFJUYXOLBJRJIJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |