C14H14BrClFN3O — CID 114435119
5-[(5-bromo-2-fluorophenyl)methylamino]-4-chloro-2-propylpyridazin-3-one (PubChem CID 114435119) has the molecular formula C14H14BrClFN3O and a molecular weight of 374.64 g/mol. Its IUPAC name is 5-[(5-bromo-2-fluorophenyl)methylamino]-4-chloro-2-propylpyridazin-3-one.
| Compound Name | 5-[(5-bromo-2-fluorophenyl)methylamino]-4-chloro-2-propylpyridazin-3-one |
|---|---|
| PubChem CID | 114435119 |
| Molecular Formula | C14H14BrClFN3O |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 5-[(5-bromo-2-fluorophenyl)methylamino]-4-chloro-2-propylpyridazin-3-one |
| SMILES | CCCn1ncc(NCc2cc(Br)ccc2F)c(Cl)c1=O |
| InChI | InChI=1S/C14H14BrClFN3O/c1-2-5-20-14(21)13(16)12(8-19-20)18-7-9-6-10(15)3-4-11(9)17/h3-4,6,8,18H,2,5,7H2,1H3 |
| InChIKey | WLAFIJFTKWAWLN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |