C14H17BrClN3OS — CID 114435450
4-bromo-5-[1-(5-chlorothiophen-2-yl)ethylamino]-2-(2-methylpropyl)pyridazin-3-one (PubChem CID 114435450) has the molecular formula C14H17BrClN3OS and a molecular weight of 390.73 g/mol. Its IUPAC name is 4-bromo-5-[1-(5-chlorothiophen-2-yl)ethylamino]-2-(2-methylpropyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-[1-(5-chlorothiophen-2-yl)ethylamino]-2-(2-methylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114435450 |
| Molecular Formula | C14H17BrClN3OS |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 4-bromo-5-[1-(5-chlorothiophen-2-yl)ethylamino]-2-(2-methylpropyl)pyridazin-3-one |
| SMILES | CC(C)Cn1ncc(NC(C)c2ccc(Cl)s2)c(Br)c1=O |
| InChI | InChI=1S/C14H17BrClN3OS/c1-8(2)7-19-14(20)13(15)10(6-17-19)18-9(3)11-4-5-12(16)21-11/h4-6,8-9,18H,7H2,1-3H3 |
| InChIKey | YUWXIKRHHJKDPU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |