C24H20ClN5O3S — CID 1144355
2-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide (PubChem CID 1144355) has the molecular formula C24H20ClN5O3S and a molecular weight of 493.98 g/mol. Its IUPAC name is 2-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1144355 |
| Molecular Formula | C24H20ClN5O3S |
| Molecular Weight | 493.98 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(-n2c(Cc3ccccc3)nnc2SCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H20ClN5O3S/c1-16-7-10-19(11-8-16)29-22(13-17-5-3-2-4-6-17)27-28-24(29)34-15-23(31)26-18-9-12-20(25)21(14-18)30(32)33/h2-12,14H,13,15H2,1H3,(H,26,31) |
| InChIKey | DGDOORWOPZJDEY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.98 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|