C29H39NO5Si — CID 11443597
(2,4,6-trimethylphenyl) (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-(4-methoxyanilino)propanoate (PubChem CID 11443597) has the molecular formula C29H39NO5Si and a molecular weight of 509.72 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-(4-methoxyanilino)propanoate.
| Compound Name | (2,4,6-trimethylphenyl) (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-(4-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 11443597 |
| Molecular Formula | C29H39NO5Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (2,4,6-trimethylphenyl) (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(furan-2-yl)-3-(4-methoxyanilino)propanoate |
| SMILES | COc1ccc(N[C@H](c2ccco2)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)Oc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C29H39NO5Si/c1-19-17-20(2)26(21(3)18-19)34-28(31)27(35-36(8,9)29(4,5)6)25(24-11-10-16-33-24)30-22-12-14-23(32-7)15-13-22/h10-18,25,27,30H,1-9H3/t25-,27-/m1/s1 |
| InChIKey | ICUNGECYIZVNTC-XNMGPUDCSA-N |
| XLogP | 7.36 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|