C13H21BrN4O — CID 114436218
4-bromo-2-ethyl-5-[(1-methylpiperidin-4-yl)methylamino]pyridazin-3-one (PubChem CID 114436218) has the molecular formula C13H21BrN4O and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-bromo-2-ethyl-5-[(1-methylpiperidin-4-yl)methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-ethyl-5-[(1-methylpiperidin-4-yl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114436218 |
| Molecular Formula | C13H21BrN4O |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-bromo-2-ethyl-5-[(1-methylpiperidin-4-yl)methylamino]pyridazin-3-one |
| SMILES | CCn1ncc(NCC2CCN(C)CC2)c(Br)c1=O |
| InChI | InChI=1S/C13H21BrN4O/c1-3-18-13(19)12(14)11(9-16-18)15-8-10-4-6-17(2)7-5-10/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | QZRVECOGZFJVEW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |