About 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one
4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one (PubChem CID 114436371) has the molecular formula C13H17ClN4O2
and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one |
| PubChem CID | 114436371 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one |
| SMILES | Cc1cc(CNc2cnn(CC(C)C)c(=O)c2Cl)no1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-8(2)7-18-13(19)12(14)11(6-16-18)15-5-10-4-9(3)20-17-10/h4,6,8,15H,5,7H2,1-3H3 |
| InChIKey | GOBHSMVEWLPKSN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one?
The IUPAC name of 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one (CID 114436371) is 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one.
What is the SMILES notation for 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one?
The canonical SMILES for 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one is Cc1cc(CNc2cnn(CC(C)C)c(=O)c2Cl)no1.
What is the InChIKey of 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one?
The InChIKey is GOBHSMVEWLPKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4O2/c1-8(2)7-18-13(19)12(14)11(6-16-18)15-5-10-4-9(3)20-17-10/h4,6,8,15H,5,7H2,1-3H3.
What are the key properties of 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one?
4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one has a molecular weight of 296.76 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-[(5-methyl-1,2-oxazol-3-yl)methylamino]-2-(2-methylpropyl)pyridazin-3-one is sourced from PubChem (CID 114436371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).