C24H50O2SiSn — CID 11443750
trimethyl-[(E)-4-(oxan-2-yloxy)-1-tributylstannylbut-2-en-2-yl]silane (PubChem CID 11443750) has the molecular formula C24H50O2SiSn and a molecular weight of 517.46 g/mol. Its IUPAC name is trimethyl-[(E)-4-(oxan-2-yloxy)-1-tributylstannylbut-2-en-2-yl]silane.
| Compound Name | trimethyl-[(E)-4-(oxan-2-yloxy)-1-tributylstannylbut-2-en-2-yl]silane |
|---|---|
| PubChem CID | 11443750 |
| Molecular Formula | C24H50O2SiSn |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | trimethyl-[(E)-4-(oxan-2-yloxy)-1-tributylstannylbut-2-en-2-yl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C/C(=C\COC1CCCCO1)[Si](C)(C)C |
| InChI | InChI=1S/C12H23O2Si.3C4H9.Sn/c1-11(15(2,3)4)8-10-14-12-7-5-6-9-13-12;3*1-3-4-2;/h8,12H,1,5-7,9-10H2,2-4H3;3*1,3-4H2,2H3;/b11-8+;;;; |
| InChIKey | NEFQXSFLZPMDMF-VANXHXJPSA-N |
| XLogP | 8.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|