C12H15BrN4O2 — CID 114437939
4-bromo-5-[(6-oxopiperidin-3-yl)amino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114437939) has the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 4-bromo-5-[(6-oxopiperidin-3-yl)amino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(6-oxopiperidin-3-yl)amino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114437939 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-bromo-5-[(6-oxopiperidin-3-yl)amino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NC2CCC(=O)NC2)c(Br)c1=O |
| InChI | InChI=1S/C12H15BrN4O2/c1-2-5-17-12(19)11(13)9(7-15-17)16-8-3-4-10(18)14-6-8/h2,7-8,16H,1,3-6H2,(H,14,18) |
| InChIKey | IJBKHKXUUSITMC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|