C29H36N4O5 — CID 11443799
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(5-ethyl-4-hydroxy-2-methoxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 11443799) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(5-ethyl-4-hydroxy-2-methoxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(5-ethyl-4-hydroxy-2-methoxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 11443799 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(5-ethyl-4-hydroxy-2-methoxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | CCc1cc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)c(OC)cc1O |
| InChI | InChI=1S/C29H36N4O5/c1-5-19-13-20(25(37-4)15-23(19)34)10-11-29(21-8-6-7-9-21)16-24(35)22(27(36)38-29)14-26-31-28-30-17(2)12-18(3)33(28)32-26/h12-13,15,21-22,34H,5-11,14,16H2,1-4H3 |
| InChIKey | XBKVMRFQOUNSSP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|