C10H13BrF3N3O3 — CID 114438157
4-bromo-2-(2-hydroxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one (PubChem CID 114438157) has the molecular formula C10H13BrF3N3O3 and a molecular weight of 360.13 g/mol. Its IUPAC name is 4-bromo-2-(2-hydroxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-(2-hydroxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114438157 |
| Molecular Formula | C10H13BrF3N3O3 |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 4-bromo-2-(2-hydroxyethyl)-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridazin-3-one |
| SMILES | O=c1c(Br)c(NCCOCC(F)(F)F)cnn1CCO |
| InChI | InChI=1S/C10H13BrF3N3O3/c11-8-7(5-16-17(2-3-18)9(8)19)15-1-4-20-6-10(12,13)14/h5,15,18H,1-4,6H2 |
| InChIKey | IXJCGIBTRUFFQK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|