C27H26N2O7S — CID 11443830
ethyl (2S,3R,4S)-1-benzyl-4-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate (PubChem CID 11443830) has the molecular formula C27H26N2O7S and a molecular weight of 522.58 g/mol. Its IUPAC name is ethyl (2S,3R,4S)-1-benzyl-4-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4S)-1-benzyl-4-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11443830 |
| Molecular Formula | C27H26N2O7S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | ethyl (2S,3R,4S)-1-benzyl-4-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccc([N+](=O)[O-])cc2)[C@H](S(=O)(=O)c2ccc(C)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H26N2O7S/c1-3-36-27(31)24-23(20-11-13-21(14-12-20)29(32)33)25(37(34,35)22-15-9-18(2)10-16-22)26(30)28(24)17-19-7-5-4-6-8-19/h4-16,23-25H,3,17H2,1-2H3/t23-,24+,25+/m1/s1 |
| InChIKey | JYTPJBKIBNKQCC-DSITVLBTSA-N |
| XLogP | 3.80 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|