C12H17ClN4O2 — CID 114438693
4-chloro-5-[(5-oxopyrrolidin-2-yl)methylamino]-2-propylpyridazin-3-one (PubChem CID 114438693) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 4-chloro-5-[(5-oxopyrrolidin-2-yl)methylamino]-2-propylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(5-oxopyrrolidin-2-yl)methylamino]-2-propylpyridazin-3-one |
|---|---|
| PubChem CID | 114438693 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-chloro-5-[(5-oxopyrrolidin-2-yl)methylamino]-2-propylpyridazin-3-one |
| SMILES | CCCn1ncc(NCC2CCC(=O)N2)c(Cl)c1=O |
| InChI | InChI=1S/C12H17ClN4O2/c1-2-5-17-12(19)11(13)9(7-15-17)14-6-8-3-4-10(18)16-8/h7-8,14H,2-6H2,1H3,(H,16,18) |
| InChIKey | HJABMFLERPGFQQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |