C27H29Cl2N3O4 — CID 11443953
3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[1-(1-oxidopyridin-1-ium-4-yl)piperidin-4-yl]methyl]benzamide (PubChem CID 11443953) has the molecular formula C27H29Cl2N3O4 and a molecular weight of 530.45 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[1-(1-oxidopyridin-1-ium-4-yl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[1-(1-oxidopyridin-1-ium-4-yl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 11443953 |
| Molecular Formula | C27H29Cl2N3O4 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[1-(1-oxidopyridin-1-ium-4-yl)piperidin-4-yl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC2CCN(c3cc[n+]([O-])cc3)CC2)cc1OCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H29Cl2N3O4/c1-35-25-5-3-21(16-26(25)36-15-10-20-2-4-22(28)17-24(20)29)27(33)30-18-19-6-11-31(12-7-19)23-8-13-32(34)14-9-23/h2-5,8-9,13-14,16-17,19H,6-7,10-12,15,18H2,1H3,(H,30,33) |
| InChIKey | FBTFPMRXJWAEPC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|